C32H46N4O2S2 — CID 71476383
S-[6-[2-(6-acetylsulfanylhexyl)-4,5-bis(2-imidazol-1-ylethyl)phenyl]hexyl] ethanethioate (PubChem CID 71476383) has the molecular formula C32H46N4O2S2 and a molecular weight of 582.88 g/mol. Its IUPAC name is S-[6-[2-(6-acetylsulfanylhexyl)-4,5-bis(2-imidazol-1-ylethyl)phenyl]hexyl] ethanethioate.
| Compound Name | S-[6-[2-(6-acetylsulfanylhexyl)-4,5-bis(2-imidazol-1-ylethyl)phenyl]hexyl] ethanethioate |
|---|---|
| PubChem CID | 71476383 |
| Molecular Formula | C32H46N4O2S2 |
| Molecular Weight | 582.88 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | S-[6-[2-(6-acetylsulfanylhexyl)-4,5-bis(2-imidazol-1-ylethyl)phenyl]hexyl] ethanethioate |
| SMILES | CC(=O)SCCCCCCc1cc(CCn2ccnc2)c(CCn2ccnc2)cc1CCCCCCSC(C)=O |
| InChI | InChI=1S/C32H46N4O2S2/c1-27(37)39-21-9-5-3-7-11-29-23-31(13-17-35-19-15-33-25-35)32(14-18-36-20-16-34-26-36)24-30(29)12-8-4-6-10-22-40-28(2)38/h15-16,19-20,23-26H,3-14,17-18,21-22H2,1-2H3 |
| InChIKey | XONYFIZYTXTCCA-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.88 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|