C26H38N8 — CID 71478868
N',N'-dimethyl-N-[7-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]-6-phenylpteridin-4-yl]ethane-1,2-diamine (PubChem CID 71478868) has the molecular formula C26H38N8 and a molecular weight of 462.65 g/mol. Its IUPAC name is N',N'-dimethyl-N-[7-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]-6-phenylpteridin-4-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[7-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]-6-phenylpteridin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 71478868 |
| Molecular Formula | C26H38N8 |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | N',N'-dimethyl-N-[7-methyl-2-[4-(4-methylpiperazin-1-yl)butyl]-6-phenylpteridin-4-yl]ethane-1,2-diamine |
| SMILES | Cc1nc2nc(CCCCN3CCN(C)CC3)nc(NCCN(C)C)c2nc1-c1ccccc1 |
| InChI | InChI=1S/C26H38N8/c1-20-23(21-10-6-5-7-11-21)31-24-25(27-13-15-32(2)3)29-22(30-26(24)28-20)12-8-9-14-34-18-16-33(4)17-19-34/h5-7,10-11H,8-9,12-19H2,1-4H3,(H,27,28,29,30) |
| InChIKey | RUMBWOQBTGKCOD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|