C20H22N4S — CID 71479411
5-phenyl-N-[4-(2-pyrrolidin-2-ylethyl)-2-pyridinyl]-1,3-thiazol-2-amine (PubChem CID 71479411) has the molecular formula C20H22N4S and a molecular weight of 350.49 g/mol. Its IUPAC name is 5-phenyl-N-[4-(2-pyrrolidin-2-ylethyl)-2-pyridinyl]-1,3-thiazol-2-amine.
| Compound Name | 5-phenyl-N-[4-(2-pyrrolidin-2-ylethyl)-2-pyridinyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 71479411 |
| Molecular Formula | C20H22N4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 5-phenyl-N-[4-(2-pyrrolidin-2-ylethyl)-2-pyridinyl]-1,3-thiazol-2-amine |
| SMILES | c1ccc(-c2cnc(Nc3cc(CCC4CCCN4)ccn3)s2)cc1 |
| InChI | InChI=1S/C20H22N4S/c1-2-5-16(6-3-1)18-14-23-20(25-18)24-19-13-15(10-12-22-19)8-9-17-7-4-11-21-17/h1-3,5-6,10,12-14,17,21H,4,7-9,11H2,(H,22,23,24) |
| InChIKey | IZAIMPHQNRCJPJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |