C13H11N3O — CID 71479963
5-(2-methylphenoxy)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 71479963) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 5-(2-methylphenoxy)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 5-(2-methylphenoxy)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 71479963 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 5-(2-methylphenoxy)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1ccccc1Oc1cccc2nncn12 |
| InChI | InChI=1S/C13H11N3O/c1-10-5-2-3-6-11(10)17-13-8-4-7-12-15-14-9-16(12)13/h2-9H,1H3 |
| InChIKey | KOTRJFHNPAUZFO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |