C22H39NO5 — CID 71481428
tert-butyl N-[3-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate (PubChem CID 71481428) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is tert-butyl N-[3-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[3-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 71481428 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | tert-butyl N-[3-[(2Z,4R,5S)-5-hydroxy-6-methoxy-2,4-dimethylocta-2,7-dienoxy]propyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(CCCOC/C(C)=C\[C@@H](C)[C@H](O)C(C=C)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39NO5/c1-9-12-23(21(25)28-22(5,6)7)13-11-14-27-16-17(3)15-18(4)20(24)19(10-2)26-8/h9-10,15,18-20,24H,1-2,11-14,16H2,3-8H3/b17-15-/t18-,19?,20+/m1/s1 |
| InChIKey | UWXDCYNWCPKIPK-IERFRWSUSA-N |
| XLogP | 3.96 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|