C24H17ClN4O3 — CID 71482435
2-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile (PubChem CID 71482435) has the molecular formula C24H17ClN4O3 and a molecular weight of 444.88 g/mol. Its IUPAC name is 2-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
|---|---|
| PubChem CID | 71482435 |
| Molecular Formula | C24H17ClN4O3 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 2-amino-4-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromene-3-carbonitrile |
| SMILES | Cc1ccc2oc(=O)c3c(c2c1)OC(N)=C(C#N)C3c1c(C)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C24H17ClN4O3/c1-12-8-9-17-15(10-12)21-20(24(30)31-17)19(16(11-26)23(27)32-21)18-13(2)28-29(22(18)25)14-6-4-3-5-7-14/h3-10,19H,27H2,1-2H3 |
| InChIKey | LEOZNTSWGRIPLG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|