C26H28FN5O3 — CID 71484025
(Z)-4-(4-ethylpiperazin-1-yl)-N-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3-methyl-4-oxobut-2-enamide (PubChem CID 71484025) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is (Z)-4-(4-ethylpiperazin-1-yl)-N-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3-methyl-4-oxobut-2-enamide.
| Compound Name | (Z)-4-(4-ethylpiperazin-1-yl)-N-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3-methyl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 71484025 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (Z)-4-(4-ethylpiperazin-1-yl)-N-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3-methyl-4-oxobut-2-enamide |
| SMILES | CCN1CCN(C(=O)/C(C)=C\C(=O)Nc2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1 |
| InChI | InChI=1S/C26H28FN5O3/c1-3-31-10-12-32(13-11-31)26(35)17(2)14-24(33)28-23-16-18(8-9-21(23)27)15-22-19-6-4-5-7-20(19)25(34)30-29-22/h4-9,14,16H,3,10-13,15H2,1-2H3,(H,28,33)(H,30,34)/b17-14- |
| InChIKey | UUZCKZPPXIVOAX-VKAVYKQESA-N |
| XLogP | 2.70 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|