C16H18N2O2 — CID 71485093
2-benzyl-6,7-dimethyl-8,8a-dihydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 71485093) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-benzyl-6,7-dimethyl-8,8a-dihydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-benzyl-6,7-dimethyl-8,8a-dihydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 71485093 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-benzyl-6,7-dimethyl-8,8a-dihydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | CC1=C(C)CN2C(=O)N(Cc3ccccc3)C(=O)C2C1 |
| InChI | InChI=1S/C16H18N2O2/c1-11-8-14-15(19)18(10-13-6-4-3-5-7-13)16(20)17(14)9-12(11)2/h3-7,14H,8-10H2,1-2H3 |
| InChIKey | IBOLCSMAZYSFRC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|