C21H25N3O8S — CID 71486927
1-hydroxy-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propane-1-sulfonic acid (PubChem CID 71486927) has the molecular formula C21H25N3O8S and a molecular weight of 479.51 g/mol. Its IUPAC name is 1-hydroxy-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propane-1-sulfonic acid.
| Compound Name | 1-hydroxy-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 71486927 |
| Molecular Formula | C21H25N3O8S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-hydroxy-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propane-1-sulfonic acid |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCC(=O)NC(Cc1ccccc1)C(O)S(=O)(=O)O |
| InChI | InChI=1S/C21H25N3O8S/c25-18(12-23-21(28)32-14-16-9-5-2-6-10-16)22-13-19(26)24-17(20(27)33(29,30)31)11-15-7-3-1-4-8-15/h1-10,17,20,27H,11-14H2,(H,22,25)(H,23,28)(H,24,26)(H,29,30,31) |
| InChIKey | ONUHXNCFBKJPGX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|