C12H16F3N2+ — CID 7148700
N-[4-(trifluoromethyl)phenyl]piperidin-1-ium-4-amine (PubChem CID 7148700) has the molecular formula C12H16F3N2+ and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)phenyl]piperidin-1-ium-4-amine.
| Compound Name | N-[4-(trifluoromethyl)phenyl]piperidin-1-ium-4-amine |
|---|---|
| PubChem CID | 7148700 |
| Molecular Formula | C12H16F3N2+ |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[4-(trifluoromethyl)phenyl]piperidin-1-ium-4-amine |
| SMILES | FC(F)(F)c1ccc(NC2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C12H15F3N2/c13-12(14,15)9-1-3-10(4-2-9)17-11-5-7-16-8-6-11/h1-4,11,16-17H,5-8H2/p+1 |
| InChIKey | BYQLBAFAFQPRPU-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 28.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |