C12H12F2O3S — CID 71490282
5-[benzenesulfonyl(difluoro)methyl]-3,4-dihydro-2H-pyran (PubChem CID 71490282) has the molecular formula C12H12F2O3S and a molecular weight of 274.29 g/mol. Its IUPAC name is 5-[benzenesulfonyl(difluoro)methyl]-3,4-dihydro-2H-pyran.
| Compound Name | 5-[benzenesulfonyl(difluoro)methyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 71490282 |
| Molecular Formula | C12H12F2O3S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-[benzenesulfonyl(difluoro)methyl]-3,4-dihydro-2H-pyran |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C1=COCCC1 |
| InChI | InChI=1S/C12H12F2O3S/c13-12(14,10-5-4-8-17-9-10)18(15,16)11-6-2-1-3-7-11/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | MNQVRBDQMUYNLJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |