C18H23NO5S — CID 71490480
ethyl 4-[(3,3-dimethyloxiran-2-yl)methyl-(4-methylphenyl)sulfonylamino]but-2-ynoate (PubChem CID 71490480) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is ethyl 4-[(3,3-dimethyloxiran-2-yl)methyl-(4-methylphenyl)sulfonylamino]but-2-ynoate.
| Compound Name | ethyl 4-[(3,3-dimethyloxiran-2-yl)methyl-(4-methylphenyl)sulfonylamino]but-2-ynoate |
|---|---|
| PubChem CID | 71490480 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | ethyl 4-[(3,3-dimethyloxiran-2-yl)methyl-(4-methylphenyl)sulfonylamino]but-2-ynoate |
| SMILES | CCOC(=O)C#CCN(CC1OC1(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO5S/c1-5-23-17(20)7-6-12-19(13-16-18(3,4)24-16)25(21,22)15-10-8-14(2)9-11-15/h8-11,16H,5,12-13H2,1-4H3 |
| InChIKey | QAAGWNYKZQUUSA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|