C41H77N3O2S2 — CID 71491442
2-[[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyldisulfanyl]methyl]guanidine (PubChem CID 71491442) has the molecular formula C41H77N3O2S2 and a molecular weight of 708.22 g/mol. Its IUPAC name is 2-[[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyldisulfanyl]methyl]guanidine.
| Compound Name | 2-[[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyldisulfanyl]methyl]guanidine |
|---|---|
| PubChem CID | 71491442 |
| Molecular Formula | C41H77N3O2S2 |
| Molecular Weight | 708.22 g/mol |
| Exact Mass | 707.55 |
| IUPAC Name | 2-[[2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]propyldisulfanyl]methyl]guanidine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CSSCN=C(N)N)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C41H77N3O2S2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-45-37-40(38-47-48-39-44-41(42)43)46-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,40H,3-10,15-16,21-39H2,1-2H3,(H4,42,43,44)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | WGJSHTBRSYYZHE-MAZCIEHSSA-N |
| XLogP | 12.63 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.22 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|