C30H41NO4 — CID 71498750
(2S,4aS,6aR,6aS,6bR,8aR,12aR)-11-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-3,4,5,6,6a,7,8,8a-octahydropicene-2-carboxamide (PubChem CID 71498750) has the molecular formula C30H41NO4 and a molecular weight of 479.66 g/mol. Its IUPAC name is (2S,4aS,6aR,6aS,6bR,8aR,12aR)-11-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-3,4,5,6,6a,7,8,8a-octahydropicene-2-carboxamide.
| Compound Name | (2S,4aS,6aR,6aS,6bR,8aR,12aR)-11-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-3,4,5,6,6a,7,8,8a-octahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 71498750 |
| Molecular Formula | C30H41NO4 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | (2S,4aS,6aR,6aS,6bR,8aR,12aR)-11-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-3,4,5,6,6a,7,8,8a-octahydropicene-2-carboxamide |
| SMILES | CC1(C)C(=O)C(O)=C[C@]2(C)[C@H]3C(=O)C=C4C5=C[C@@](C)(C(N)=O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H41NO4/c1-25(2)21-8-9-30(7)22(28(21,5)16-20(33)23(25)34)19(32)14-17-18-15-27(4,24(31)35)11-10-26(18,3)12-13-29(17,30)6/h14-16,21-22,33H,8-13H2,1-7H3,(H2,31,35)/t21-,22+,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | RSHUBKYBHIWOPF-AAKWJWOGSA-N |
| XLogP | 5.60 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |