C63H59BF2N2O3 — CID 71500216
6,8,10-tris(4-butoxyphenyl)-2,2-difluoro-4,5,11,12-tetraphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71500216) has the molecular formula C63H59BF2N2O3 and a molecular weight of 940.98 g/mol. Its IUPAC name is 6,8,10-tris(4-butoxyphenyl)-2,2-difluoro-4,5,11,12-tetraphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 6,8,10-tris(4-butoxyphenyl)-2,2-difluoro-4,5,11,12-tetraphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71500216 |
| Molecular Formula | C63H59BF2N2O3 |
| Molecular Weight | 940.98 g/mol |
| Exact Mass | 940.46 |
| IUPAC Name | 6,8,10-tris(4-butoxyphenyl)-2,2-difluoro-4,5,11,12-tetraphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CCCCOc1ccc(C2=C(c3ccccc3)C(c3ccccc3)=[N+]3C2=C(c2ccc(OCCCC)cc2)c2c(-c4ccc(OCCCC)cc4)c(-c4ccccc4)c(-c4ccccc4)n2[B-]3(F)F)cc1 |
| InChI | InChI=1S/C63H59BF2N2O3/c1-4-7-42-69-52-36-30-47(31-37-52)57-55(45-22-14-10-15-23-45)60(50-26-18-12-19-27-50)67-62(57)59(49-34-40-54(41-35-49)71-44-9-6-3)63-58(48-32-38-53(39-33-48)70-43-8-5-2)56(46-24-16-11-17-25-46)61(68(63)64(67,65)66)51-28-20-13-21-29-51/h10-41H,4-9,42-44H2,1-3H3 |
| InChIKey | BWKWCIZRMQFLEU-UHFFFAOYSA-N |
| XLogP | 16.15 |
| TPSA | 35.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.98 |
| LogP ≤ 5 | 16.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|