C23H19N3O3 — CID 71500569
2-[[4-(5-phenyl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]carbamoyl]benzoic acid (PubChem CID 71500569) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[[4-(5-phenyl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-(5-phenyl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 71500569 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[[4-(5-phenyl-4,5-dihydro-1H-pyrazol-3-yl)phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccc(C2=NNC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H19N3O3/c27-22(18-8-4-5-9-19(18)23(28)29)24-17-12-10-16(11-13-17)21-14-20(25-26-21)15-6-2-1-3-7-15/h1-13,20,25H,14H2,(H,24,27)(H,28,29) |
| InChIKey | AODRULUYNKMRES-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |