C27H29N5O3 — CID 71502964
1-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]-3-[(6-oxo-1H-pyridin-3-yl)methyl]urea (PubChem CID 71502964) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 1-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]-3-[(6-oxo-1H-pyridin-3-yl)methyl]urea.
| Compound Name | 1-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]-3-[(6-oxo-1H-pyridin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 71502964 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]-3-[(6-oxo-1H-pyridin-3-yl)methyl]urea |
| SMILES | O=C(NCc1ccc(=O)[nH]c1)Nc1ccc(-n2cc(CCN3CCOCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C27H29N5O3/c33-26-10-5-20(17-28-26)18-29-27(34)30-22-6-8-23(9-7-22)32-19-21(24-3-1-2-4-25(24)32)11-12-31-13-15-35-16-14-31/h1-10,17,19H,11-16,18H2,(H,28,33)(H2,29,30,34) |
| InChIKey | FGYNQSWXAGZTNW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |