C28H31N5O2 — CID 71165107
1-[(6-methyl-3-pyridinyl)methyl]-3-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]urea (PubChem CID 71165107) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 1-[(6-methyl-3-pyridinyl)methyl]-3-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]urea.
| Compound Name | 1-[(6-methyl-3-pyridinyl)methyl]-3-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 71165107 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 1-[(6-methyl-3-pyridinyl)methyl]-3-[4-[3-(2-morpholin-4-ylethyl)indol-1-yl]phenyl]urea |
| SMILES | Cc1ccc(CNC(=O)Nc2ccc(-n3cc(CCN4CCOCC4)c4ccccc43)cc2)cn1 |
| InChI | InChI=1S/C28H31N5O2/c1-21-6-7-22(18-29-21)19-30-28(34)31-24-8-10-25(11-9-24)33-20-23(26-4-2-3-5-27(26)33)12-13-32-14-16-35-17-15-32/h2-11,18,20H,12-17,19H2,1H3,(H2,30,31,34) |
| InChIKey | VNOCDTPSVDLJAY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |