C21H39NO6Si — CID 71503819
tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(1S)-3-ethoxycarbonyl-1-hydroxybut-3-enyl]aziridine-1-carboxylate (PubChem CID 71503819) has the molecular formula C21H39NO6Si and a molecular weight of 429.63 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(1S)-3-ethoxycarbonyl-1-hydroxybut-3-enyl]aziridine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(1S)-3-ethoxycarbonyl-1-hydroxybut-3-enyl]aziridine-1-carboxylate |
|---|---|
| PubChem CID | 71503819 |
| Molecular Formula | C21H39NO6Si |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | tert-butyl (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[(1S)-3-ethoxycarbonyl-1-hydroxybut-3-enyl]aziridine-1-carboxylate |
| SMILES | C=C(C[C@H](O)[C@@H]1[C@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C21H39NO6Si/c1-11-26-18(24)14(2)12-16(23)17-15(13-27-29(9,10)21(6,7)8)22(17)19(25)28-20(3,4)5/h15-17,23H,2,11-13H2,1,3-10H3/t15-,16-,17-,22?/m0/s1 |
| InChIKey | FNNOEPBTBKOFSL-FGJWLUJVSA-N |
| XLogP | 3.87 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|