C17H31NO4 — CID 101338761
tert-butyl (2S,3R)-2-[(1R)-1-hydroxy-4,4-dimethyl-3-oxopentyl]-3-propylaziridine-1-carboxylate (PubChem CID 101338761) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[(1R)-1-hydroxy-4,4-dimethyl-3-oxopentyl]-3-propylaziridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-[(1R)-1-hydroxy-4,4-dimethyl-3-oxopentyl]-3-propylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 101338761 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | tert-butyl (2S,3R)-2-[(1R)-1-hydroxy-4,4-dimethyl-3-oxopentyl]-3-propylaziridine-1-carboxylate |
| SMILES | CCC[C@@H]1[C@@H]([C@H](O)CC(=O)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31NO4/c1-8-9-11-14(12(19)10-13(20)16(2,3)4)18(11)15(21)22-17(5,6)7/h11-12,14,19H,8-10H2,1-7H3/t11-,12-,14+,18?/m1/s1 |
| InChIKey | RWXYIRKSIQIKMA-YDGLSPAASA-N |
| XLogP | 3.14 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|