C15H29NO3 — CID 101148746
tert-butyl (2R,3S)-2-[(1R)-1-hydroxy-3-methylbutyl]-3-propylaziridine-1-carboxylate (PubChem CID 101148746) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-[(1R)-1-hydroxy-3-methylbutyl]-3-propylaziridine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-[(1R)-1-hydroxy-3-methylbutyl]-3-propylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 101148746 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | tert-butyl (2R,3S)-2-[(1R)-1-hydroxy-3-methylbutyl]-3-propylaziridine-1-carboxylate |
| SMILES | CCC[C@H]1[C@H]([C@H](O)CC(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO3/c1-7-8-11-13(12(17)9-10(2)3)16(11)14(18)19-15(4,5)6/h10-13,17H,7-9H2,1-6H3/t11-,12+,13+,16?/m0/s1 |
| InChIKey | DCRUZIOJZINXMY-NXBSNPICSA-N |
| XLogP | 3.18 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|