C17H27NO7S — CID 71503483
tert-butyl (2S,3S)-2-ethenyl-3-[(1R)-3-ethoxycarbonyl-1-methylsulfonyloxybut-3-enyl]aziridine-1-carboxylate (PubChem CID 71503483) has the molecular formula C17H27NO7S and a molecular weight of 389.47 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-ethenyl-3-[(1R)-3-ethoxycarbonyl-1-methylsulfonyloxybut-3-enyl]aziridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-ethenyl-3-[(1R)-3-ethoxycarbonyl-1-methylsulfonyloxybut-3-enyl]aziridine-1-carboxylate |
|---|---|
| PubChem CID | 71503483 |
| Molecular Formula | C17H27NO7S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | tert-butyl (2S,3S)-2-ethenyl-3-[(1R)-3-ethoxycarbonyl-1-methylsulfonyloxybut-3-enyl]aziridine-1-carboxylate |
| SMILES | C=C[C@H]1[C@@H]([C@@H](CC(=C)C(=O)OCC)OS(C)(=O)=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27NO7S/c1-8-12-14(18(12)16(20)24-17(4,5)6)13(25-26(7,21)22)10-11(3)15(19)23-9-2/h8,12-14H,1,3,9-10H2,2,4-7H3/t12-,13+,14-,18?/m0/s1 |
| InChIKey | JLOHFVZJQUBUSB-CDJKEZFESA-N |
| XLogP | 2.01 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|