C8H10O4S — CID 71503872
[(3aR,6R,6aR)-2-oxo-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-6-yl] acetate (PubChem CID 71503872) has the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. Its IUPAC name is [(3aR,6R,6aR)-2-oxo-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-6-yl] acetate.
| Compound Name | [(3aR,6R,6aR)-2-oxo-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-6-yl] acetate |
|---|---|
| PubChem CID | 71503872 |
| Molecular Formula | C8H10O4S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | [(3aR,6R,6aR)-2-oxo-3a,5,6,6a-tetrahydro-3H-thieno[3,2-b]furan-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CS[C@@H]2CC(=O)O[C@H]12 |
| InChI | InChI=1S/C8H10O4S/c1-4(9)11-5-3-13-6-2-7(10)12-8(5)6/h5-6,8H,2-3H2,1H3/t5-,6+,8+/m0/s1 |
| InChIKey | GMJWWSHZGDPEOZ-SHYZEUOFSA-N |
| XLogP | 0.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |