C7H12O5S — CID 71505612
methyl (2S,3S,4R,5R)-3,4,5-trihydroxythiane-2-carboxylate (PubChem CID 71505612) has the molecular formula C7H12O5S and a molecular weight of 208.23 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R)-3,4,5-trihydroxythiane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R)-3,4,5-trihydroxythiane-2-carboxylate |
|---|---|
| PubChem CID | 71505612 |
| Molecular Formula | C7H12O5S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | methyl (2S,3S,4R,5R)-3,4,5-trihydroxythiane-2-carboxylate |
| SMILES | COC(=O)[C@H]1SC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12O5S/c1-12-7(11)6-5(10)4(9)3(8)2-13-6/h3-6,8-10H,2H2,1H3/t3-,4+,5-,6-/m0/s1 |
| InChIKey | LDJVPOCLUIMQRD-FSIIMWSLSA-N |
| XLogP | -1.64 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |