C22H22F3NO2 — CID 71505773
(1S,3aR,9aS)-7-tert-butyl-1-[4-(trifluoromethyl)phenyl]-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one (PubChem CID 71505773) has the molecular formula C22H22F3NO2 and a molecular weight of 389.42 g/mol. Its IUPAC name is (1S,3aR,9aS)-7-tert-butyl-1-[4-(trifluoromethyl)phenyl]-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one.
| Compound Name | (1S,3aR,9aS)-7-tert-butyl-1-[4-(trifluoromethyl)phenyl]-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 71505773 |
| Molecular Formula | C22H22F3NO2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (1S,3aR,9aS)-7-tert-butyl-1-[4-(trifluoromethyl)phenyl]-3,3a,9,9a-tetrahydro-1H-cyclopenta[b][1,4]benzoxazin-2-one |
| SMILES | CC(C)(C)c1ccc2c(c1)N[C@@H]1[C@@H](CC(=O)[C@H]1c1ccc(C(F)(F)F)cc1)O2 |
| InChI | InChI=1S/C22H22F3NO2/c1-21(2,3)14-8-9-17-15(10-14)26-20-18(28-17)11-16(27)19(20)12-4-6-13(7-5-12)22(23,24)25/h4-10,18-20,26H,11H2,1-3H3/t18-,19-,20-/m1/s1 |
| InChIKey | JEASYLXUMJWSLS-VAMGGRTRSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |