C24H21ClF2N2O6S2 — CID 71510023
4-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]pyridazine (PubChem CID 71510023) has the molecular formula C24H21ClF2N2O6S2 and a molecular weight of 571.02 g/mol. Its IUPAC name is 4-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]pyridazine.
| Compound Name | 4-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]pyridazine |
|---|---|
| PubChem CID | 71510023 |
| Molecular Formula | C24H21ClF2N2O6S2 |
| Molecular Weight | 571.02 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | 4-[2-[(4S,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]pyridazine |
| SMILES | O=S(=O)(CC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12)c1ccnnc1 |
| InChI | InChI=1S/C24H21ClF2N2O6S2/c25-15-1-3-16(4-2-15)37(32,33)24-9-11-34-21(8-12-36(30,31)17-7-10-28-29-13-17)18(24)14-35-23-20(27)6-5-19(26)22(23)24/h1-7,10,13,18,21H,8-9,11-12,14H2/t18-,21-,24-/m0/s1 |
| InChIKey | GIMGXSNDEFJSPG-XZOYJPPVSA-N |
| XLogP | 3.74 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.02 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |