C29H44N2O3 — CID 71515274
methyl (3S,5R)-3-[3-aminopropyl-[(1S)-1-phenylethyl]amino]-5-phenylmethoxydecanoate (PubChem CID 71515274) has the molecular formula C29H44N2O3 and a molecular weight of 468.68 g/mol. Its IUPAC name is methyl (3S,5R)-3-[3-aminopropyl-[(1S)-1-phenylethyl]amino]-5-phenylmethoxydecanoate.
| Compound Name | methyl (3S,5R)-3-[3-aminopropyl-[(1S)-1-phenylethyl]amino]-5-phenylmethoxydecanoate |
|---|---|
| PubChem CID | 71515274 |
| Molecular Formula | C29H44N2O3 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | methyl (3S,5R)-3-[3-aminopropyl-[(1S)-1-phenylethyl]amino]-5-phenylmethoxydecanoate |
| SMILES | CCCCC[C@H](C[C@@H](CC(=O)OC)N(CCCN)[C@@H](C)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H44N2O3/c1-4-5-8-18-28(34-23-25-14-9-6-10-15-25)21-27(22-29(32)33-3)31(20-13-19-30)24(2)26-16-11-7-12-17-26/h6-7,9-12,14-17,24,27-28H,4-5,8,13,18-23,30H2,1-3H3/t24-,27-,28+/m0/s1 |
| InChIKey | YMVNWQMDMQEIGV-SAAIGDAKSA-N |
| XLogP | 5.89 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|