C21H31N5O3 — CID 71523156
[1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl] 4-cyclopentylpiperazine-1-carboxylate (PubChem CID 71523156) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is [1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl] 4-cyclopentylpiperazine-1-carboxylate.
| Compound Name | [1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl] 4-cyclopentylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 71523156 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | [1-(5-carbamoyl-2-pyridinyl)piperidin-4-yl] 4-cyclopentylpiperazine-1-carboxylate |
| SMILES | NC(=O)c1ccc(N2CCC(OC(=O)N3CCN(C4CCCC4)CC3)CC2)nc1 |
| InChI | InChI=1S/C21H31N5O3/c22-20(27)16-5-6-19(23-15-16)25-9-7-18(8-10-25)29-21(28)26-13-11-24(12-14-26)17-3-1-2-4-17/h5-6,15,17-18H,1-4,7-14H2,(H2,22,27) |
| InChIKey | ITKLGGUUOSZXGH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |