C22H21BrN2O5 — CID 71523915
ethyl 2-[6-bromo-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate (PubChem CID 71523915) has the molecular formula C22H21BrN2O5 and a molecular weight of 473.32 g/mol. Its IUPAC name is ethyl 2-[6-bromo-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate.
| Compound Name | ethyl 2-[6-bromo-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate |
|---|---|
| PubChem CID | 71523915 |
| Molecular Formula | C22H21BrN2O5 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | ethyl 2-[6-bromo-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate |
| SMILES | CCOC(=O)CC1Oc2ccc(Br)cc2C(c2cn(C)c3ccccc23)C1[N+](=O)[O-] |
| InChI | InChI=1S/C22H21BrN2O5/c1-3-29-20(26)11-19-22(25(27)28)21(15-10-13(23)8-9-18(15)30-19)16-12-24(2)17-7-5-4-6-14(16)17/h4-10,12,19,21-22H,3,11H2,1-2H3 |
| InChIKey | TWLQJGSTPGTRLM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|