C23H24N2O6 — CID 102201824
ethyl 2-[7-methoxy-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate (PubChem CID 102201824) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is ethyl 2-[7-methoxy-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate.
| Compound Name | ethyl 2-[7-methoxy-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate |
|---|---|
| PubChem CID | 102201824 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl 2-[7-methoxy-4-(1-methylindol-3-yl)-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate |
| SMILES | CCOC(=O)CC1Oc2cc(OC)ccc2C(c2cn(C)c3ccccc23)C1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N2O6/c1-4-30-21(26)12-20-23(25(27)28)22(16-10-9-14(29-3)11-19(16)31-20)17-13-24(2)18-8-6-5-7-15(17)18/h5-11,13,20,22-23H,4,12H2,1-3H3 |
| InChIKey | NPDLZMZLNQMSHA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 92.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|