C21H20BrNO6 — CID 71764681
ethyl 2-[(2S,3S,4R)-4-[2-(3-bromophenyl)-2-oxoethyl]-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate (PubChem CID 71764681) has the molecular formula C21H20BrNO6 and a molecular weight of 462.30 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4R)-4-[2-(3-bromophenyl)-2-oxoethyl]-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4R)-4-[2-(3-bromophenyl)-2-oxoethyl]-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate |
|---|---|
| PubChem CID | 71764681 |
| Molecular Formula | C21H20BrNO6 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | ethyl 2-[(2S,3S,4R)-4-[2-(3-bromophenyl)-2-oxoethyl]-3-nitro-3,4-dihydro-2H-chromen-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1Oc2ccccc2[C@@H](CC(=O)c2cccc(Br)c2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20BrNO6/c1-2-28-20(25)12-19-21(23(26)27)16(15-8-3-4-9-18(15)29-19)11-17(24)13-6-5-7-14(22)10-13/h3-10,16,19,21H,2,11-12H2,1H3/t16-,19+,21+/m1/s1 |
| InChIKey | RXYHXXJRCMSVNB-PBEJRMEISA-N |
| XLogP | 4.17 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|