C22H23NO7 — CID 71764760
ethyl 2-[(2S,3S,4R)-6-methoxy-3-nitro-4-phenacyl-3,4-dihydro-2H-chromen-2-yl]acetate (PubChem CID 71764760) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4R)-6-methoxy-3-nitro-4-phenacyl-3,4-dihydro-2H-chromen-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4R)-6-methoxy-3-nitro-4-phenacyl-3,4-dihydro-2H-chromen-2-yl]acetate |
|---|---|
| PubChem CID | 71764760 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 2-[(2S,3S,4R)-6-methoxy-3-nitro-4-phenacyl-3,4-dihydro-2H-chromen-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1Oc2ccc(OC)cc2[C@@H](CC(=O)c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23NO7/c1-3-29-21(25)13-20-22(23(26)27)17(12-18(24)14-7-5-4-6-8-14)16-11-15(28-2)9-10-19(16)30-20/h4-11,17,20,22H,3,12-13H2,1-2H3/t17-,20+,22+/m1/s1 |
| InChIKey | VWYCNMSTIAMZHE-AGHHOFFYSA-N |
| XLogP | 3.41 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|