C28H37NO3Si — CID 71530234
(4S,5R)-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylpenta-1,3-dienyl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 71530234) has the molecular formula C28H37NO3Si and a molecular weight of 463.69 g/mol. Its IUPAC name is (4S,5R)-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylpenta-1,3-dienyl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylpenta-1,3-dienyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71530234 |
| Molecular Formula | C28H37NO3Si |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (4S,5R)-3-[(1E,3E)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethylpenta-1,3-dienyl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CCC(/C=C/CO[Si](C)(C)C(C)(C)C)=C\N1C(=O)O[C@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H37NO3Si/c1-7-22(15-14-20-31-33(5,6)28(2,3)4)21-29-25(23-16-10-8-11-17-23)26(32-27(29)30)24-18-12-9-13-19-24/h8-19,21,25-26H,7,20H2,1-6H3/b15-14+,22-21+/t25-,26+/m0/s1 |
| InChIKey | UDDUGLHSVQAQBK-LGBDWHFYSA-N |
| XLogP | 7.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|