C21H34N2O2 — CID 71531721
(1R,4S,9R,10S,13R)-17-(cyclopropylmethyl)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-ene-4,10-diol (PubChem CID 71531721) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (1R,4S,9R,10S,13R)-17-(cyclopropylmethyl)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-ene-4,10-diol.
| Compound Name | (1R,4S,9R,10S,13R)-17-(cyclopropylmethyl)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-ene-4,10-diol |
|---|---|
| PubChem CID | 71531721 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | (1R,4S,9R,10S,13R)-17-(cyclopropylmethyl)-13-(methylamino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadec-2(7)-ene-4,10-diol |
| SMILES | CN[C@@H]1CC[C@@]2(O)[C@H]3CC4=C(C[C@@H](O)CC4)[C@@]2(CCN3CC2CC2)C1 |
| InChI | InChI=1S/C21H34N2O2/c1-22-16-6-7-21(25)19-10-15-4-5-17(24)11-18(15)20(21,12-16)8-9-23(19)13-14-2-3-14/h14,16-17,19,22,24-25H,2-13H2,1H3/t16-,17+,19-,20-,21-/m1/s1 |
| InChIKey | KHFKEMOLFZFJFX-CXUGJCBMSA-N |
| XLogP | 2.21 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|