About sodium;triphenylphosphane;sulfite
sodium;triphenylphosphane;sulfite (PubChem CID 71533578) has the molecular formula C18H15NaO3PS-
and a molecular weight of 365.35 g/mol. Its IUPAC name is sodium;triphenylphosphane;sulfite.
Molecular Properties
| Compound Name | sodium;triphenylphosphane;sulfite |
| PubChem CID | 71533578 |
| Molecular Formula | C18H15NaO3PS- |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | sodium;triphenylphosphane;sulfite |
| SMILES | O=S([O-])[O-].[Na+].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.Na.H2O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;1-4(2)3/h1-15H;;(H2,1,2,3)/q;+1;/p-2 |
| InChIKey | AHHRGYRUACXPAN-UHFFFAOYSA-L |
| XLogP | -0.56 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;triphenylphosphane;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;triphenylphosphane;sulfite?
The IUPAC name of sodium;triphenylphosphane;sulfite (CID 71533578) is sodium;triphenylphosphane;sulfite.
What is the SMILES notation for sodium;triphenylphosphane;sulfite?
The canonical SMILES for sodium;triphenylphosphane;sulfite is O=S([O-])[O-].[Na+].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sodium;triphenylphosphane;sulfite?
The InChIKey is AHHRGYRUACXPAN-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H15P.Na.H2O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;1-4(2)3/h1-15H;;(H2,1,2,3)/q;+1;/p-2.
What are the key properties of sodium;triphenylphosphane;sulfite?
sodium;triphenylphosphane;sulfite has a molecular weight of 365.35 g/mol, XLogP of -0.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;triphenylphosphane;sulfite is sourced from PubChem (CID 71533578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).