C14H28O4 — CID 71534405
2-[(4S,5R,6S)-6-[(2R,3S)-3-methoxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethanol (PubChem CID 71534405) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 2-[(4S,5R,6S)-6-[(2R,3S)-3-methoxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethanol.
| Compound Name | 2-[(4S,5R,6S)-6-[(2R,3S)-3-methoxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethanol |
|---|---|
| PubChem CID | 71534405 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-[(4S,5R,6S)-6-[(2R,3S)-3-methoxybutan-2-yl]-2,2,5-trimethyl-1,3-dioxan-4-yl]ethanol |
| SMILES | CO[C@@H](C)[C@@H](C)[C@@H]1OC(C)(C)O[C@@H](CCO)[C@H]1C |
| InChI | InChI=1S/C14H28O4/c1-9(11(3)16-6)13-10(2)12(7-8-15)17-14(4,5)18-13/h9-13,15H,7-8H2,1-6H3/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | YUGREZNZJKLTPY-BNDIWNMDSA-N |
| XLogP | 2.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |