C22H37NO3 — CID 71536833
(2S,4R,6R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(Z)-non-1-enyl]-7-oxa-1-azabicyclo[2.2.1]heptane (PubChem CID 71536833) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is (2S,4R,6R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(Z)-non-1-enyl]-7-oxa-1-azabicyclo[2.2.1]heptane.
| Compound Name | (2S,4R,6R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(Z)-non-1-enyl]-7-oxa-1-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 71536833 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | (2S,4R,6R)-2-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-6-[(Z)-non-1-enyl]-7-oxa-1-azabicyclo[2.2.1]heptane |
| SMILES | CCCCCCC/C=C\[C@H]1C[C@@H]2C[C@@H]([C@H]3COC4(CCCCC4)O3)N1O2 |
| InChI | InChI=1S/C22H37NO3/c1-2-3-4-5-6-7-9-12-18-15-19-16-20(23(18)26-19)21-17-24-22(25-21)13-10-8-11-14-22/h9,12,18-21H,2-8,10-11,13-17H2,1H3/b12-9-/t18-,19+,20-,21+/m0/s1 |
| InChIKey | ILAFHAGKZOAOHX-YSCDKTCJSA-N |
| XLogP | 5.13 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|