C47H83NO2 — CID 58069640
(3aS,6aS)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,4'-cyclohexane] (PubChem CID 58069640) has the molecular formula C47H83NO2 and a molecular weight of 694.19 g/mol. Its IUPAC name is (3aS,6aS)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,4'-cyclohexane].
| Compound Name | (3aS,6aS)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,4'-cyclohexane] |
|---|---|
| PubChem CID | 58069640 |
| Molecular Formula | C47H83NO2 |
| Molecular Weight | 694.19 g/mol |
| Exact Mass | 693.64 |
| IUPAC Name | (3aS,6aS)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,4'-cyclohexane] |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)CCC2(CC1)O[C@H]1CN(C)C[C@@H]1O2 |
| InChI | InChI=1S/C47H83NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-46(38-40-47(41-39-46)49-44-42-48(3)43-45(44)50-47)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,44-45H,4-11,16-17,22-43H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t44-,45-/m0/s1 |
| InChIKey | SLBTVVUAFVXCEI-FVYQRGQGSA-N |
| XLogP | 14.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.19 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|