C46H81NO2 — CID 58069735
(3aR,6aR)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane] (PubChem CID 58069735) has the molecular formula C46H81NO2 and a molecular weight of 680.16 g/mol. Its IUPAC name is (3aR,6aR)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane].
| Compound Name | (3aR,6aR)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane] |
|---|---|
| PubChem CID | 58069735 |
| Molecular Formula | C46H81NO2 |
| Molecular Weight | 680.16 g/mol |
| Exact Mass | 679.63 |
| IUPAC Name | (3aR,6aR)-5-methyl-1',1'-bis[(9Z,12Z)-octadeca-9,12-dienyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane] |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)CCC2(C1)O[C@@H]1CN(C)C[C@H]1O2 |
| InChI | InChI=1S/C46H81NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-45(38-39-46(42-45)48-43-40-47(3)41-44(43)49-46)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,43-44H,4-11,16-17,22-42H2,1-3H3/b14-12-,15-13-,20-18-,21-19-/t43-,44-/m1/s1 |
| InChIKey | QWRPYFWBKFKDGV-PMJOZSTPSA-N |
| XLogP | 13.99 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.16 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|