C41H73NO2 — CID 122435250
(3aS,6aS)-3'-[(7Z,10Z)-hexadeca-7,10-dienyl]-3'-[(Z)-hexadec-7-enyl]-5-methylspiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclobutane] (PubChem CID 122435250) has the molecular formula C41H73NO2 and a molecular weight of 612.04 g/mol. Its IUPAC name is (3aS,6aS)-3'-[(7Z,10Z)-hexadeca-7,10-dienyl]-3'-[(Z)-hexadec-7-enyl]-5-methylspiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclobutane].
| Compound Name | (3aS,6aS)-3'-[(7Z,10Z)-hexadeca-7,10-dienyl]-3'-[(Z)-hexadec-7-enyl]-5-methylspiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclobutane] |
|---|---|
| PubChem CID | 122435250 |
| Molecular Formula | C41H73NO2 |
| Molecular Weight | 612.04 g/mol |
| Exact Mass | 611.56 |
| IUPAC Name | (3aS,6aS)-3'-[(7Z,10Z)-hexadeca-7,10-dienyl]-3'-[(Z)-hexadec-7-enyl]-5-methylspiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,1'-cyclobutane] |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC1(CCCCCC/C=C\CCCCCCCC)CC2(C1)O[C@H]1CN(C)C[C@@H]1O2 |
| InChI | InChI=1S/C41H73NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-40(36-41(37-40)43-38-34-42(3)35-39(38)44-41)33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12,14,18-21,38-39H,4-11,13,15-17,22-37H2,1-3H3/b14-12-,20-18-,21-19-/t38-,39-/m0/s1 |
| InChIKey | ISCBFNYVUUDAOK-VKBSXZOESA-N |
| XLogP | 12.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.04 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|