C36H65NO2 — CID 149023551
(3aR,6aS)-5-methyl-1',1'-bis[(Z)-tridec-9-enyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane] (PubChem CID 149023551) has the molecular formula C36H65NO2 and a molecular weight of 543.92 g/mol. Its IUPAC name is (3aR,6aS)-5-methyl-1',1'-bis[(Z)-tridec-9-enyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane].
| Compound Name | (3aR,6aS)-5-methyl-1',1'-bis[(Z)-tridec-9-enyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane] |
|---|---|
| PubChem CID | 149023551 |
| Molecular Formula | C36H65NO2 |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 543.50 |
| IUPAC Name | (3aR,6aS)-5-methyl-1',1'-bis[(Z)-tridec-9-enyl]spiro[3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-2,3'-cyclopentane] |
| SMILES | CCC/C=C\CCCCCCCCC1(CCCCCCCC/C=C\CCC)CCC2(C1)O[C@H]1CN(C)C[C@H]1O2 |
| InChI | InChI=1S/C36H65NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-35(27-25-23-21-19-17-15-13-11-9-7-5-2)28-29-36(32-35)38-33-30-37(3)31-34(33)39-36/h8-11,33-34H,4-7,12-32H2,1-3H3/b10-8-,11-9-/t33-,34+,36? |
| InChIKey | QDXWAUJMDBOFOL-BWLIBLQDSA-N |
| XLogP | 10.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|