C18H33NO2 — CID 10968444
(8S,10S)-8-methyl-10-[(E)-non-1-enyl]-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 10968444) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is (8S,10S)-8-methyl-10-[(E)-non-1-enyl]-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | (8S,10S)-8-methyl-10-[(E)-non-1-enyl]-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10968444 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | (8S,10S)-8-methyl-10-[(E)-non-1-enyl]-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CCCCCCC/C=C/[C@@H]1CC2(C[C@H](C)N1)OCCCO2 |
| InChI | InChI=1S/C18H33NO2/c1-3-4-5-6-7-8-9-11-17-15-18(14-16(2)19-17)20-12-10-13-21-18/h9,11,16-17,19H,3-8,10,12-15H2,1-2H3/b11-9+/t16-,17+/m0/s1 |
| InChIKey | HBPZBFBUNKSPPD-DMFQBTPQSA-N |
| XLogP | 4.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|