C47H54O10 — CID 71538266
9,19,24,26,28,32-hexaethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8(33),9,11(32),13(31),14,16(30),18(29),19,21(28),23,26,34-pentadecaene-4,14,30,34-tetrol (PubChem CID 71538266) has the molecular formula C47H54O10 and a molecular weight of 778.94 g/mol. Its IUPAC name is 9,19,24,26,28,32-hexaethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8(33),9,11(32),13(31),14,16(30),18(29),19,21(28),23,26,34-pentadecaene-4,14,30,34-tetrol.
| Compound Name | 9,19,24,26,28,32-hexaethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8(33),9,11(32),13(31),14,16(30),18(29),19,21(28),23,26,34-pentadecaene-4,14,30,34-tetrol |
|---|---|
| PubChem CID | 71538266 |
| Molecular Formula | C47H54O10 |
| Molecular Weight | 778.94 g/mol |
| Exact Mass | 778.37 |
| IUPAC Name | 9,19,24,26,28,32-hexaethoxyhexacyclo[21.2.2.23,6.28,11.213,16.218,21]pentatriaconta-1(25),3,5,8(33),9,11(32),13(31),14,16(30),18(29),19,21(28),23,26,34-pentadecaene-4,14,30,34-tetrol |
| SMILES | CCOc1cc2c(OCC)cc1Cc1cc(O)c(cc1O)Cc1cc(OCC)c(cc1OCC)Cc1cc(OCC)c(cc1OCC)Cc1cc(O)c(cc1O)C2 |
| InChI | InChI=1S/C47H54O10/c1-7-52-42-22-33-14-29-19-41(51)31(21-39(29)49)16-35-25-47(57-12-6)37(27-45(35)55-10-4)17-36-26-44(54-9-3)34(24-46(36)56-11-5)15-30-20-38(48)28(18-40(30)50)13-32(42)23-43(33)53-8-2/h18-27,48-51H,7-17H2,1-6H3 |
| InChIKey | SFFOSHAZPHDOQD-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.94 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|