C15H28N2S — CID 71540931
1-tert-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea (PubChem CID 71540931) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea.
| Compound Name | 1-tert-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea |
|---|---|
| PubChem CID | 71540931 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-tert-butyl-3-[(2E)-3,7-dimethylocta-2,6-dienyl]thiourea |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C15H28N2S/c1-12(2)8-7-9-13(3)10-11-16-14(18)17-15(4,5)6/h8,10H,7,9,11H2,1-6H3,(H2,16,17,18)/b13-10+ |
| InChIKey | UYSPTPPNOASTNW-JLHYYAGUSA-N |
| XLogP | 3.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|