C21H27N3O3 — CID 71541070
(3-piperazin-1-ylphenyl) N-(4-butoxyphenyl)carbamate (PubChem CID 71541070) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (3-piperazin-1-ylphenyl) N-(4-butoxyphenyl)carbamate.
| Compound Name | (3-piperazin-1-ylphenyl) N-(4-butoxyphenyl)carbamate |
|---|---|
| PubChem CID | 71541070 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3-piperazin-1-ylphenyl) N-(4-butoxyphenyl)carbamate |
| SMILES | CCCCOc1ccc(NC(=O)Oc2cccc(N3CCNCC3)c2)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-2-3-15-26-19-9-7-17(8-10-19)23-21(25)27-20-6-4-5-18(16-20)24-13-11-22-12-14-24/h4-10,16,22H,2-3,11-15H2,1H3,(H,23,25) |
| InChIKey | SFZOMIUWFZEMNS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|