C29H46N2O4S2 — CID 71543558
5-[[4-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-2,2-bis(sulfanyl)butyl]amino]-5-oxopentanoic acid (PubChem CID 71543558) has the molecular formula C29H46N2O4S2 and a molecular weight of 550.83 g/mol. Its IUPAC name is 5-[[4-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-2,2-bis(sulfanyl)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-2,2-bis(sulfanyl)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71543558 |
| Molecular Formula | C29H46N2O4S2 |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 5-[[4-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-2,2-bis(sulfanyl)butyl]amino]-5-oxopentanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCC(S)(S)CNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C29H46N2O4S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-26(32)30-24-23-29(36,37)25-31-27(33)21-19-22-28(34)35/h3-4,6-7,9-10,12-13,15-16,36-37H,2,5,8,11,14,17-25H2,1H3,(H,30,32)(H,31,33)(H,34,35)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | SKLHVTJYSCSHHZ-JLNKQSITSA-N |
| XLogP | 6.34 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|