C21H31ClN8O — CID 7154836
(2R)-2-[1-[(1S,2S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-yl]tetrazol-5-yl]-N,N-dimethylbutan-2-amine (PubChem CID 7154836) has the molecular formula C21H31ClN8O and a molecular weight of 446.99 g/mol. Its IUPAC name is (2R)-2-[1-[(1S,2S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-yl]tetrazol-5-yl]-N,N-dimethylbutan-2-amine.
| Compound Name | (2R)-2-[1-[(1S,2S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-yl]tetrazol-5-yl]-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 7154836 |
| Molecular Formula | C21H31ClN8O |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (2R)-2-[1-[(1S,2S)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-yl]tetrazol-5-yl]-N,N-dimethylbutan-2-amine |
| SMILES | CC[C@](C)(c1nnnn1[C@H]([C@H](Oc1ccc(Cl)cc1)n1cncn1)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C21H31ClN8O/c1-8-21(5,28(6)7)19-25-26-27-30(19)17(20(2,3)4)18(29-14-23-13-24-29)31-16-11-9-15(22)10-12-16/h9-14,17-18H,8H2,1-7H3/t17-,18+,21-/m1/s1 |
| InChIKey | VFTQONPYVZINMK-LVCYWYKZSA-N |
| XLogP | 3.97 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |