C22H24N6O5S — CID 71553524
[2-acetamido-4-[[5-carbamoyl-4-[[(1R)-1-phenylethyl]amino]pyrimidin-2-yl]amino]phenyl] methanesulfonate (PubChem CID 71553524) has the molecular formula C22H24N6O5S and a molecular weight of 484.54 g/mol. Its IUPAC name is [2-acetamido-4-[[5-carbamoyl-4-[[(1R)-1-phenylethyl]amino]pyrimidin-2-yl]amino]phenyl] methanesulfonate.
| Compound Name | [2-acetamido-4-[[5-carbamoyl-4-[[(1R)-1-phenylethyl]amino]pyrimidin-2-yl]amino]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 71553524 |
| Molecular Formula | C22H24N6O5S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [2-acetamido-4-[[5-carbamoyl-4-[[(1R)-1-phenylethyl]amino]pyrimidin-2-yl]amino]phenyl] methanesulfonate |
| SMILES | CC(=O)Nc1cc(Nc2ncc(C(N)=O)c(N[C@H](C)c3ccccc3)n2)ccc1OS(C)(=O)=O |
| InChI | InChI=1S/C22H24N6O5S/c1-13(15-7-5-4-6-8-15)25-21-17(20(23)30)12-24-22(28-21)27-16-9-10-19(33-34(3,31)32)18(11-16)26-14(2)29/h4-13H,1-3H3,(H2,23,30)(H,26,29)(H2,24,25,27,28)/t13-/m1/s1 |
| InChIKey | DTAGNYFUZZRZPZ-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 165.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|