C17H23N5O5S — CID 71554313
[4-[[5-carbamoyl-4-[[(2R)-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]-2-hydroxyphenyl] methanesulfonate (PubChem CID 71554313) has the molecular formula C17H23N5O5S and a molecular weight of 409.47 g/mol. Its IUPAC name is [4-[[5-carbamoyl-4-[[(2R)-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]-2-hydroxyphenyl] methanesulfonate.
| Compound Name | [4-[[5-carbamoyl-4-[[(2R)-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]-2-hydroxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 71554313 |
| Molecular Formula | C17H23N5O5S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [4-[[5-carbamoyl-4-[[(2R)-3-methylbutan-2-yl]amino]pyrimidin-2-yl]amino]-2-hydroxyphenyl] methanesulfonate |
| SMILES | CC(C)[C@@H](C)Nc1nc(Nc2ccc(OS(C)(=O)=O)c(O)c2)ncc1C(N)=O |
| InChI | InChI=1S/C17H23N5O5S/c1-9(2)10(3)20-16-12(15(18)24)8-19-17(22-16)21-11-5-6-14(13(23)7-11)27-28(4,25)26/h5-10,23H,1-4H3,(H2,18,24)(H2,19,20,21,22)/t10-/m1/s1 |
| InChIKey | MYFZBPLQQSQMPD-SNVBAGLBSA-N |
| XLogP | 1.82 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|