C23H26FN5O4S — CID 71554218
(R)-[4-[[5-carbamoyl-4-(3-methylbutan-2-ylamino)pyrimidin-2-yl]amino]phenyl]-fluoro-phenylmethanesulfonic acid (PubChem CID 71554218) has the molecular formula C23H26FN5O4S and a molecular weight of 487.56 g/mol. Its IUPAC name is (R)-[4-[[5-carbamoyl-4-(3-methylbutan-2-ylamino)pyrimidin-2-yl]amino]phenyl]-fluoro-phenylmethanesulfonic acid.
| Compound Name | (R)-[4-[[5-carbamoyl-4-(3-methylbutan-2-ylamino)pyrimidin-2-yl]amino]phenyl]-fluoro-phenylmethanesulfonic acid |
|---|---|
| PubChem CID | 71554218 |
| Molecular Formula | C23H26FN5O4S |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (R)-[4-[[5-carbamoyl-4-(3-methylbutan-2-ylamino)pyrimidin-2-yl]amino]phenyl]-fluoro-phenylmethanesulfonic acid |
| SMILES | CC(C)C(C)Nc1nc(Nc2ccc([C@@](F)(c3ccccc3)S(=O)(=O)O)cc2)ncc1C(N)=O |
| InChI | InChI=1S/C23H26FN5O4S/c1-14(2)15(3)27-21-19(20(25)30)13-26-22(29-21)28-18-11-9-17(10-12-18)23(24,34(31,32)33)16-7-5-4-6-8-16/h4-15H,1-3H3,(H2,25,30)(H,31,32,33)(H2,26,27,28,29)/t15?,23-/m1/s1 |
| InChIKey | DTYMTGBKKKWPMJ-RYDFDWSBSA-N |
| XLogP | 3.83 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|